C16H29NO8P2 — CID 171745090
tert-butyl-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy-hydroxyphosphoryl]oxyphosphinic acid (PubChem CID 171745090) has the molecular formula C16H29NO8P2 and a molecular weight of 425.36 g/mol. Its IUPAC name is tert-butyl-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy-hydroxyphosphoryl]oxyphosphinic acid.
| Compound Name | tert-butyl-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy-hydroxyphosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 171745090 |
| Molecular Formula | C16H29NO8P2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | tert-butyl-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy-hydroxyphosphoryl]oxyphosphinic acid |
| SMILES | CC(C)(C)P(=O)(O)OP(=O)(O)OCCNC(=O)COC1C#CCCCCC1 |
| InChI | InChI=1S/C16H29NO8P2/c1-16(2,3)26(19,20)25-27(21,22)24-12-11-17-15(18)13-23-14-9-7-5-4-6-8-10-14/h14H,4-7,9,11-13H2,1-3H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | IYIPDDJRLNYIIU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|