C13H22N2O2 — CID 156533282
3-amino-N-(2-cyclooct-2-yn-1-yloxyethyl)propanamide (PubChem CID 156533282) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-amino-N-(2-cyclooct-2-yn-1-yloxyethyl)propanamide.
| Compound Name | 3-amino-N-(2-cyclooct-2-yn-1-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 156533282 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-amino-N-(2-cyclooct-2-yn-1-yloxyethyl)propanamide |
| SMILES | NCCC(=O)NCCOC1C#CCCCCC1 |
| InChI | InChI=1S/C13H22N2O2/c14-9-8-13(16)15-10-11-17-12-6-4-2-1-3-5-7-12/h12H,1-4,6,8-11,14H2,(H,15,16) |
| InChIKey | IUFMDRLYCCKRDM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|