C12H20NO5P — CID 130277556
2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethylphosphonic acid (PubChem CID 130277556) has the molecular formula C12H20NO5P and a molecular weight of 289.27 g/mol. Its IUPAC name is 2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethylphosphonic acid.
| Compound Name | 2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 130277556 |
| Molecular Formula | C12H20NO5P |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethylphosphonic acid |
| SMILES | O=C(COC1C#CCCCCC1)NCCP(=O)(O)O |
| InChI | InChI=1S/C12H20NO5P/c14-12(13-8-9-19(15,16)17)10-18-11-6-4-2-1-3-5-7-11/h11H,1-4,6,8-10H2,(H,13,14)(H2,15,16,17) |
| InChIKey | UAXRCYFOARGQAY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|