C22H38N2O7 — CID 175802436
4-[2-[2-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]butanamide (PubChem CID 175802436) has the molecular formula C22H38N2O7 and a molecular weight of 442.55 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]butanamide.
| Compound Name | 4-[2-[2-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]butanamide |
|---|---|
| PubChem CID | 175802436 |
| Molecular Formula | C22H38N2O7 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 4-[2-[2-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]butanamide |
| SMILES | NC(=O)CCCOCCOCCOCCOCCNC(=O)COC1C#CCCCCC1 |
| InChI | InChI=1S/C22H38N2O7/c23-21(25)9-6-11-27-13-15-29-17-18-30-16-14-28-12-10-24-22(26)19-31-20-7-4-2-1-3-5-8-20/h20H,1-4,6-7,9-19H2,(H2,23,25)(H,24,26) |
| InChIKey | NGRGKPHXGHGEFK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|