C22H36O8 — CID 163880006
3-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 163880006) has the molecular formula C22H36O8 and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 163880006 |
| Molecular Formula | C22H36O8 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOCCCC(=O)COC1C#CCCCCC1 |
| InChI | InChI=1S/C22H36O8/c23-20(19-30-21-8-4-2-1-3-5-9-21)7-6-11-26-13-15-28-17-18-29-16-14-27-12-10-22(24)25/h21H,1-4,6-8,10-19H2,(H,24,25) |
| InChIKey | PSIQBUFZOXKAMX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|