C26H28IO5S2- — CID 163420496
2-[3-(triphenyl-λ4-sulfanyl)iodanuidylcyclopentanecarbonyl]oxyethanesulfonic acid (PubChem CID 163420496) has the molecular formula C26H28IO5S2- and a molecular weight of 611.54 g/mol. Its IUPAC name is 2-[3-(triphenyl-λ4-sulfanyl)iodanuidylcyclopentanecarbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(triphenyl-λ4-sulfanyl)iodanuidylcyclopentanecarbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 163420496 |
| Molecular Formula | C26H28IO5S2- |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.04 |
| IUPAC Name | 2-[3-(triphenyl-λ4-sulfanyl)iodanuidylcyclopentanecarbonyl]oxyethanesulfonic acid |
| SMILES | O=C(OCCS(=O)(=O)O)C1CCC([I-]S(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H28IO5S2/c28-26(32-18-19-33(29,30)31)21-16-17-22(20-21)27-34(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,21-22H,16-20H2,(H,29,30,31)/q-1 |
| InChIKey | POXUDRCARVSJMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|