C7H10O7S — CID 163626928
2-(2-oxooxolane-3-carbonyl)oxyethanesulfonic acid (PubChem CID 163626928) has the molecular formula C7H10O7S and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-(2-oxooxolane-3-carbonyl)oxyethanesulfonic acid.
| Compound Name | 2-(2-oxooxolane-3-carbonyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 163626928 |
| Molecular Formula | C7H10O7S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 2-(2-oxooxolane-3-carbonyl)oxyethanesulfonic acid |
| SMILES | O=C1OCCC1C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C7H10O7S/c8-6-5(1-2-13-6)7(9)14-3-4-15(10,11)12/h5H,1-4H2,(H,10,11,12) |
| InChIKey | HSURVRKONSGIBA-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|