C12H20O8S — CID 129061911
2-[2-(methoxymethoxycarbonyl)cyclohexanecarbonyl]oxyethanesulfonic acid (PubChem CID 129061911) has the molecular formula C12H20O8S and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[2-(methoxymethoxycarbonyl)cyclohexanecarbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-(methoxymethoxycarbonyl)cyclohexanecarbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 129061911 |
| Molecular Formula | C12H20O8S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[2-(methoxymethoxycarbonyl)cyclohexanecarbonyl]oxyethanesulfonic acid |
| SMILES | COCOC(=O)C1CCCCC1C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C12H20O8S/c1-18-8-20-12(14)10-5-3-2-4-9(10)11(13)19-6-7-21(15,16)17/h9-10H,2-8H2,1H3,(H,15,16,17) |
| InChIKey | IWZWKKBDNZGTHM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|