C12H26BN2O9P — CID 163427030
[2-[[(E)-3-boronoprop-2-enyl]carbamoyloxy]-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 163427030) has the molecular formula C12H26BN2O9P and a molecular weight of 384.13 g/mol. Its IUPAC name is [2-[[(E)-3-boronoprop-2-enyl]carbamoyloxy]-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[[(E)-3-boronoprop-2-enyl]carbamoyloxy]-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 163427030 |
| Molecular Formula | C12H26BN2O9P |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-[[(E)-3-boronoprop-2-enyl]carbamoyloxy]-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCC(CO)OC(=O)NC/C=C/B(O)O |
| InChI | InChI=1S/C12H26BN2O9P/c1-15(2,3)7-8-22-25(20,21)23-10-11(9-16)24-12(17)14-6-4-5-13(18)19/h4-5,11,16,18-19H,6-10H2,1-3H3,(H-,14,17,20,21)/b5-4+ |
| InChIKey | HVQJYMXUGFEVMD-SNAWJCMRSA-N |
| XLogP | -2.15 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|