C26H41F3O3 — CID 163428164
(3S,8S,9S,10R,13R,14R,17R)-3-(methoxymethyl)-8,10,13-trimethyl-17-[(2S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 163428164) has the molecular formula C26H41F3O3 and a molecular weight of 458.61 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14R,17R)-3-(methoxymethyl)-8,10,13-trimethyl-17-[(2S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14R,17R)-3-(methoxymethyl)-8,10,13-trimethyl-17-[(2S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163428164 |
| Molecular Formula | C26H41F3O3 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (3S,8S,9S,10R,13R,14R,17R)-3-(methoxymethyl)-8,10,13-trimethyl-17-[(2S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COC[C@]1(O)CC[C@@]2(C)C(=CC[C@@]3(C)[C@@H]4CC[C@H]([C@H](C)C(O)C(F)(F)F)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H41F3O3/c1-16(21(30)26(27,28)29)18-6-7-19-23(18,3)11-9-20-22(2)12-13-25(31,15-32-5)14-17(22)8-10-24(19,20)4/h8,16,18-21,30-31H,6-7,9-15H2,1-5H3/t16-,18+,19+,20+,21?,22-,23+,24-,25-/m0/s1 |
| InChIKey | AOGZBEXXRZFBJI-XITJBVPXSA-N |
| XLogP | 5.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|