C4H11N9S3 — CID 163431315
[[amino-[bis(carbamothioylamino)amino]methylidene]amino]thiourea (PubChem CID 163431315) has the molecular formula C4H11N9S3 and a molecular weight of 281.40 g/mol. Its IUPAC name is [[amino-[bis(carbamothioylamino)amino]methylidene]amino]thiourea.
| Compound Name | [[amino-[bis(carbamothioylamino)amino]methylidene]amino]thiourea |
|---|---|
| PubChem CID | 163431315 |
| Molecular Formula | C4H11N9S3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [[amino-[bis(carbamothioylamino)amino]methylidene]amino]thiourea |
| SMILES | NC(=S)NN=C(N)N(NC(N)=S)NC(N)=S |
| InChI | InChI=1S/C4H11N9S3/c5-1(9-10-2(6)14)13(11-3(7)15)12-4(8)16/h(H2,5,9)(H3,6,10,14)(H3,7,11,15)(H3,8,12,16) |
| InChIKey | AQSMYVMRXPIAJP-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 155.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|