C20H37NO2 — CID 163431806
(1S,3S)-1-amino-1-[(2R)-2-[(E)-3-methoxypent-2-en-2-yl]cyclopropyl]-3-methyldecan-2-one (PubChem CID 163431806) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (1S,3S)-1-amino-1-[(2R)-2-[(E)-3-methoxypent-2-en-2-yl]cyclopropyl]-3-methyldecan-2-one.
| Compound Name | (1S,3S)-1-amino-1-[(2R)-2-[(E)-3-methoxypent-2-en-2-yl]cyclopropyl]-3-methyldecan-2-one |
|---|---|
| PubChem CID | 163431806 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (1S,3S)-1-amino-1-[(2R)-2-[(E)-3-methoxypent-2-en-2-yl]cyclopropyl]-3-methyldecan-2-one |
| SMILES | CCCCCCC[C@H](C)C(=O)[C@@H](N)C1C[C@H]1/C(C)=C(\CC)OC |
| InChI | InChI=1S/C20H37NO2/c1-6-8-9-10-11-12-14(3)20(22)19(21)17-13-16(17)15(4)18(7-2)23-5/h14,16-17,19H,6-13,21H2,1-5H3/b18-15+/t14-,16-,17?,19-/m0/s1 |
| InChIKey | ARDGMXBKGGJQOB-WAIYGMOKSA-N |
| XLogP | 4.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|