C28H48N4O14 — CID 163434845
1-(6-amino-6-oxohexanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide (PubChem CID 163434845) has the molecular formula C28H48N4O14 and a molecular weight of 664.71 g/mol. Its IUPAC name is 1-(6-amino-6-oxohexanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide.
| Compound Name | 1-(6-amino-6-oxohexanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 163434845 |
| Molecular Formula | C28H48N4O14 |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | 1-(6-amino-6-oxohexanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide |
| SMILES | C[C@@H]1O[C@@H](OCCNC(=O)C2CCC(C(=O)NCCO[C@@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]3O)N2C(=O)CCCCC(N)=O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H48N4O14/c1-13-19(35)21(37)23(39)27(45-13)43-11-9-30-25(41)15-7-8-16(32(15)18(34)6-4-3-5-17(29)33)26(42)31-10-12-44-28-24(40)22(38)20(36)14(2)46-28/h13-16,19-24,27-28,35-40H,3-12H2,1-2H3,(H2,29,33)(H,30,41)(H,31,42)/t13-,14-,15?,16?,19+,20+,21+,22+,23-,24-,27+,28+/m0/s1 |
| InChIKey | ATOXCRDNARBOKB-KAHOSYFNSA-N |
| XLogP | -4.69 |
| TPSA | 279.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|