C29H49N3O14 — CID 122522423
(2S,5S)-1-(6-oxoheptanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide (PubChem CID 122522423) has the molecular formula C29H49N3O14 and a molecular weight of 663.72 g/mol. Its IUPAC name is (2S,5S)-1-(6-oxoheptanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide.
| Compound Name | (2S,5S)-1-(6-oxoheptanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 122522423 |
| Molecular Formula | C29H49N3O14 |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | (2S,5S)-1-(6-oxoheptanoyl)-2-N,5-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]pyrrolidine-2,5-dicarboxamide |
| SMILES | CC(=O)CCCCC(=O)N1[C@H](C(=O)NCCO[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)CC[C@H]1C(=O)NCCO[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H49N3O14/c1-14(33)6-4-5-7-19(34)32-17(26(41)30-10-12-43-28-24(39)22(37)20(35)15(2)45-28)8-9-18(32)27(42)31-11-13-44-29-25(40)23(38)21(36)16(3)46-29/h15-18,20-25,28-29,35-40H,4-13H2,1-3H3,(H,30,41)(H,31,42)/t15-,16-,17-,18-,20+,21+,22+,23+,24-,25-,28+,29+/m0/s1 |
| InChIKey | KCQAYCOARJKEAL-NHVPIMHQSA-N |
| XLogP | -3.58 |
| TPSA | 253.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|