C15H25N3O4 — CID 159697583
(2S)-2-N,5-N-dimethyl-1-(6-oxoheptanoyl)pyrrolidine-2,5-dicarboxamide (PubChem CID 159697583) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-2-N,5-N-dimethyl-1-(6-oxoheptanoyl)pyrrolidine-2,5-dicarboxamide.
| Compound Name | (2S)-2-N,5-N-dimethyl-1-(6-oxoheptanoyl)pyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 159697583 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2S)-2-N,5-N-dimethyl-1-(6-oxoheptanoyl)pyrrolidine-2,5-dicarboxamide |
| SMILES | CNC(=O)C1CC[C@@H](C(=O)NC)N1C(=O)CCCCC(C)=O |
| InChI | InChI=1S/C15H25N3O4/c1-10(19)6-4-5-7-13(20)18-11(14(21)16-2)8-9-12(18)15(22)17-3/h11-12H,4-9H2,1-3H3,(H,16,21)(H,17,22)/t11-,12?/m0/s1 |
| InChIKey | KQKPRYULHORBGN-PXYINDEMSA-N |
| XLogP | -0.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|