C30H53N3O13 — CID 118017125
(3R,4R)-1-(6-oxoheptyl)-3-N,4-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]piperidine-3,4-dicarboxamide (PubChem CID 118017125) has the molecular formula C30H53N3O13 and a molecular weight of 663.76 g/mol. Its IUPAC name is (3R,4R)-1-(6-oxoheptyl)-3-N,4-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]piperidine-3,4-dicarboxamide.
| Compound Name | (3R,4R)-1-(6-oxoheptyl)-3-N,4-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]piperidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 118017125 |
| Molecular Formula | C30H53N3O13 |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | (3R,4R)-1-(6-oxoheptyl)-3-N,4-N-bis[2-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethyl]piperidine-3,4-dicarboxamide |
| SMILES | CC(=O)CCCCCN1CC[C@@H](C(=O)NCCO[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)[C@@H](C(=O)NCCO[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C30H53N3O13/c1-16(34)7-5-4-6-11-33-12-8-19(27(41)31-9-13-43-29-25(39)23(37)21(35)17(2)45-29)20(15-33)28(42)32-10-14-44-30-26(40)24(38)22(36)18(3)46-30/h17-26,29-30,35-40H,4-15H2,1-3H3,(H,31,41)(H,32,42)/t17-,18-,19+,20-,21+,22+,23+,24+,25-,26-,29+,30+/m0/s1 |
| InChIKey | PUCYQOAHEHAFPT-VPCSNMMBSA-N |
| XLogP | -3.01 |
| TPSA | 236.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|