C11H10N2O5 — CID 163435231
5-[(3,4-dihydroxycyclohexa-2,4-dien-1-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 163435231) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-[(3,4-dihydroxycyclohexa-2,4-dien-1-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3,4-dihydroxycyclohexa-2,4-dien-1-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163435231 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-[(3,4-dihydroxycyclohexa-2,4-dien-1-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=CC2C=C(O)C(O)=CC2)C(=O)N1 |
| InChI | InChI=1S/C11H10N2O5/c14-7-2-1-5(4-8(7)15)3-6-9(16)12-11(18)13-10(6)17/h2-5,14-15H,1H2,(H2,12,13,16,17,18) |
| InChIKey | ATXWPLZTPCVZLS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|