C10H12 — CID 163437767
tetracyclo[4.4.0.02,4.07,9]dec-4-ene (PubChem CID 163437767) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is tetracyclo[4.4.0.02,4.07,9]dec-4-ene.
| Compound Name | tetracyclo[4.4.0.02,4.07,9]dec-4-ene |
|---|---|
| PubChem CID | 163437767 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | tetracyclo[4.4.0.02,4.07,9]dec-4-ene |
| SMILES | C1=C2CC2C2CC3CC3C12 |
| InChI | InChI=1S/C10H12/c1-5-3-10-8-2-6(8)4-9(10)7(1)5/h3,6-10H,1-2,4H2 |
| InChIKey | AVYKWHKATIXXER-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|