C9H12 — CID 163938709
(7R)-7-methyltricyclo[3.2.1.03,8]oct-2-ene (PubChem CID 163938709) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is (7R)-7-methyltricyclo[3.2.1.03,8]oct-2-ene.
| Compound Name | (7R)-7-methyltricyclo[3.2.1.03,8]oct-2-ene |
|---|---|
| PubChem CID | 163938709 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (7R)-7-methyltricyclo[3.2.1.03,8]oct-2-ene |
| SMILES | C[C@@H]1CC2CC3=CC1C32 |
| InChI | InChI=1S/C9H12/c1-5-2-6-3-7-4-8(5)9(6)7/h4-6,8-9H,2-3H2,1H3/t5-,6?,8?,9?/m1/s1 |
| InChIKey | RPBVYXFJFUPFSN-DOCOQKPTSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|