C14H24 — CID 144769271
2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene (PubChem CID 144769271) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene.
| Compound Name | 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 144769271 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| SMILES | CC1=CC2CC(C)C(C)CC2CC1C |
| InChI | InChI=1S/C14H24/c1-9-5-13-7-11(3)12(4)8-14(13)6-10(9)2/h5,10-14H,6-8H2,1-4H3 |
| InChIKey | WPFRCUGRUAXXSW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|