C11H20 — CID 163545872
(6S)-3-ethyl-1,4,6-trimethylcyclohexene (PubChem CID 163545872) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (6S)-3-ethyl-1,4,6-trimethylcyclohexene.
| Compound Name | (6S)-3-ethyl-1,4,6-trimethylcyclohexene |
|---|---|
| PubChem CID | 163545872 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (6S)-3-ethyl-1,4,6-trimethylcyclohexene |
| SMILES | CCC1C=C(C)[C@@H](C)CC1C |
| InChI | InChI=1S/C11H20/c1-5-11-7-9(3)8(2)6-10(11)4/h7-8,10-11H,5-6H2,1-4H3/t8-,10?,11?/m0/s1 |
| InChIKey | FEYZNYYDYAFWDV-PUSIOWJLSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|