C9H16 — CID 163464724
(3R,4S)-3-ethyl-1,4-dimethylcyclopentene (PubChem CID 163464724) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-1,4-dimethylcyclopentene.
| Compound Name | (3R,4S)-3-ethyl-1,4-dimethylcyclopentene |
|---|---|
| PubChem CID | 163464724 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (3R,4S)-3-ethyl-1,4-dimethylcyclopentene |
| SMILES | CC[C@H]1C=C(C)C[C@@H]1C |
| InChI | InChI=1S/C9H16/c1-4-9-6-7(2)5-8(9)3/h6,8-9H,4-5H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | BROCRINKISNCBW-IUCAKERBSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|