C14H18 — CID 123553439
11-methylpentacyclo[6.5.0.02,7.03,13.05,9]tridec-12-ene (PubChem CID 123553439) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 11-methylpentacyclo[6.5.0.02,7.03,13.05,9]tridec-12-ene.
| Compound Name | 11-methylpentacyclo[6.5.0.02,7.03,13.05,9]tridec-12-ene |
|---|---|
| PubChem CID | 123553439 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 11-methylpentacyclo[6.5.0.02,7.03,13.05,9]tridec-12-ene |
| SMILES | CC1C=C2C3CC4CC5C3C2C5C4C1 |
| InChI | InChI=1S/C14H18/c1-6-2-8-7-4-10-9(3-6)14-12(8)11(5-7)13(10)14/h3,6-8,10-14H,2,4-5H2,1H3 |
| InChIKey | FAPWCUYMPUZHCD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|