C15H24O3Si — CID 140537347
trimethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-8-enyl)silane (PubChem CID 140537347) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is trimethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-8-enyl)silane.
| Compound Name | trimethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-8-enyl)silane |
|---|---|
| PubChem CID | 140537347 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | trimethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-8-enyl)silane |
| SMILES | CO[Si](OC)(OC)C1CC2CC1C1C3CC=C(C3)C21 |
| InChI | InChI=1S/C15H24O3Si/c1-16-19(17-2,18-3)13-8-11-7-12(13)15-10-5-4-9(6-10)14(11)15/h4,10-15H,5-8H2,1-3H3 |
| InChIKey | NDWXLRVXMZKGNL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|