C13H16NO2- — CID 163458366
10-oxido-11-oxa-10-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-5-ene (PubChem CID 163458366) has the molecular formula C13H16NO2- and a molecular weight of 218.28 g/mol. Its IUPAC name is 10-oxido-11-oxa-10-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-5-ene.
| Compound Name | 10-oxido-11-oxa-10-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-5-ene |
|---|---|
| PubChem CID | 163458366 |
| Molecular Formula | C13H16NO2- |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 10-oxido-11-oxa-10-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-5-ene |
| SMILES | [O-]N1OCC2C3CC(C4C5=CCC(C5)C34)C21 |
| InChI | InChI=1S/C13H16NO2/c15-14-13-9-4-8(10(13)5-16-14)11-6-1-2-7(3-6)12(9)11/h2,6,8-13H,1,3-5H2/q-1 |
| InChIKey | OZVJLRDXAQMKLV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|