C8H12NO2- — CID 163489177
(1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane (PubChem CID 163489177) has the molecular formula C8H12NO2- and a molecular weight of 154.19 g/mol. Its IUPAC name is (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 163489177 |
| Molecular Formula | C8H12NO2- |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane |
| SMILES | [O-]N1OCC2C3CC[C@H](C3)C21 |
| InChI | InChI=1S/C8H12NO2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h5-8H,1-4H2/q-1/t5?,6-,7?,8?/m1/s1 |
| InChIKey | LBLBUYLKHBIDJF-QQJWGCFSSA-N |
| XLogP | 1.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |