About (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane
(1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane (PubChem CID 163489177) has the molecular formula C8H12NO2-
and a molecular weight of 154.19 g/mol. Its IUPAC name is (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane |
| PubChem CID | 163489177 |
| Molecular Formula | C8H12NO2- |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane |
| SMILES | [O-]N1OCC2C3CC[C@H](C3)C21 |
| InChI | InChI=1S/C8H12NO2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h5-8H,1-4H2/q-1/t5?,6-,7?,8?/m1/s1 |
| InChIKey | LBLBUYLKHBIDJF-QQJWGCFSSA-N |
| XLogP | 1.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane?
The IUPAC name of (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane (CID 163489177) is (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane?
The canonical SMILES for (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane is [O-]N1OCC2C3CC[C@H](C3)C21.
What is the InChIKey of (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane?
The InChIKey is LBLBUYLKHBIDJF-QQJWGCFSSA-N. The full InChI is InChI=1S/C8H12NO2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h5-8H,1-4H2/q-1/t5?,6-,7?,8?/m1/s1.
What are the key properties of (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane?
(1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane has a molecular weight of 154.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-oxido-4-oxa-3-azatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 163489177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).