C32H40ClN5O6S — CID 163438599
N-[6-[1-(4-chlorobenzoyl)-3-ethyl-2-methylindol-5-yl]oxyhexyl]-2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetamide (PubChem CID 163438599) has the molecular formula C32H40ClN5O6S and a molecular weight of 658.22 g/mol. Its IUPAC name is N-[6-[1-(4-chlorobenzoyl)-3-ethyl-2-methylindol-5-yl]oxyhexyl]-2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetamide.
| Compound Name | N-[6-[1-(4-chlorobenzoyl)-3-ethyl-2-methylindol-5-yl]oxyhexyl]-2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 163438599 |
| Molecular Formula | C32H40ClN5O6S |
| Molecular Weight | 658.22 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | N-[6-[1-(4-chlorobenzoyl)-3-ethyl-2-methylindol-5-yl]oxyhexyl]-2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetamide |
| SMILES | CCc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OCCCCCCNC(=O)CNC(=O)CNC(=O)CNC(=O)CS)cc12 |
| InChI | InChI=1S/C32H40ClN5O6S/c1-3-25-21(2)38(32(43)22-8-10-23(33)11-9-22)27-13-12-24(16-26(25)27)44-15-7-5-4-6-14-34-28(39)17-35-29(40)18-36-30(41)19-37-31(42)20-45/h8-13,16,45H,3-7,14-15,17-20H2,1-2H3,(H,34,39)(H,35,40)(H,36,41)(H,37,42) |
| InChIKey | MUHUTTYABDFVKM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|