C26H27N5O3S — CID 163441662
(1S,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(1R)-1-phenylethyl]amino]pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol (PubChem CID 163441662) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(1R)-1-phenylethyl]amino]pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol.
| Compound Name | (1S,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(1R)-1-phenylethyl]amino]pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol |
|---|---|
| PubChem CID | 163441662 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (1S,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(1R)-1-phenylethyl]amino]pyrimidin-4-yl]amino]bicyclo[3.1.0]hexane-1,2,6-triol |
| SMILES | Cc1nc(N[C@H](C)c2ccccc2)nc(N[C@@H]2C[C@@H]3C(O)[C@]3(O)[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H27N5O3S/c1-13(15-8-4-3-5-9-15)27-25-28-14(2)20(24-30-17-10-6-7-11-19(17)35-24)23(31-25)29-18-12-16-21(32)26(16,34)22(18)33/h3-11,13,16,18,21-22,32-34H,12H2,1-2H3,(H2,27,28,29,31)/t13-,16-,18-,21?,22+,26+/m1/s1 |
| InChIKey | AZBSDLSAIKFFER-BSYAKFEHSA-N |
| XLogP | 3.50 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |