C18H29NO2S — CID 163441854
4-methyl-1-[3-(2,4,6-trimethylphenyl)sulfonylpropyl]piperidine (PubChem CID 163441854) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is 4-methyl-1-[3-(2,4,6-trimethylphenyl)sulfonylpropyl]piperidine.
| Compound Name | 4-methyl-1-[3-(2,4,6-trimethylphenyl)sulfonylpropyl]piperidine |
|---|---|
| PubChem CID | 163441854 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4-methyl-1-[3-(2,4,6-trimethylphenyl)sulfonylpropyl]piperidine |
| SMILES | Cc1cc(C)c(S(=O)(=O)CCCN2CCC(C)CC2)c(C)c1 |
| InChI | InChI=1S/C18H29NO2S/c1-14-6-9-19(10-7-14)8-5-11-22(20,21)18-16(3)12-15(2)13-17(18)4/h12-14H,5-11H2,1-4H3 |
| InChIKey | AZFXYGQFIRECSS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |