C15H24N2O2S — CID 21260407
[4-(2,4,6-trimethylphenyl)sulfonylpiperidin-1-yl]methanamine (PubChem CID 21260407) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is [4-(2,4,6-trimethylphenyl)sulfonylpiperidin-1-yl]methanamine.
| Compound Name | [4-(2,4,6-trimethylphenyl)sulfonylpiperidin-1-yl]methanamine |
|---|---|
| PubChem CID | 21260407 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [4-(2,4,6-trimethylphenyl)sulfonylpiperidin-1-yl]methanamine |
| SMILES | Cc1cc(C)c(S(=O)(=O)C2CCN(CN)CC2)c(C)c1 |
| InChI | InChI=1S/C15H24N2O2S/c1-11-8-12(2)15(13(3)9-11)20(18,19)14-4-6-17(10-16)7-5-14/h8-9,14H,4-7,10,16H2,1-3H3 |
| InChIKey | KFOGHTZYJXIQNS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |