C30H42O6S2 — CID 163443545
4-[4-[(3Z)-cyclododec-3-en-1-yl]phenyl]sulfonyloxy-2,6-di(propan-2-yl)benzenesulfonic acid (PubChem CID 163443545) has the molecular formula C30H42O6S2 and a molecular weight of 562.79 g/mol. Its IUPAC name is 4-[4-[(3Z)-cyclododec-3-en-1-yl]phenyl]sulfonyloxy-2,6-di(propan-2-yl)benzenesulfonic acid.
| Compound Name | 4-[4-[(3Z)-cyclododec-3-en-1-yl]phenyl]sulfonyloxy-2,6-di(propan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 163443545 |
| Molecular Formula | C30H42O6S2 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 4-[4-[(3Z)-cyclododec-3-en-1-yl]phenyl]sulfonyloxy-2,6-di(propan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)c1cc(OS(=O)(=O)c2ccc(C3C/C=C\CCCCCCCC3)cc2)cc(C(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C30H42O6S2/c1-22(2)28-20-26(21-29(23(3)4)30(28)37(31,32)33)36-38(34,35)27-18-16-25(17-19-27)24-14-12-10-8-6-5-7-9-11-13-15-24/h10,12,16-24H,5-9,11,13-15H2,1-4H3,(H,31,32,33)/b12-10- |
| InChIKey | BAOXGAXWPPHGAX-BENRWUELSA-N |
| XLogP | 8.11 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|