C32H46O3S2 — CID 146264794
(3,5-dicyclopentyl-4-methylsulfanylphenyl) 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 146264794) has the molecular formula C32H46O3S2 and a molecular weight of 542.85 g/mol. Its IUPAC name is (3,5-dicyclopentyl-4-methylsulfanylphenyl) 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | (3,5-dicyclopentyl-4-methylsulfanylphenyl) 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 146264794 |
| Molecular Formula | C32H46O3S2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (3,5-dicyclopentyl-4-methylsulfanylphenyl) 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CSc1c(C2CCCC2)cc(OS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1C1CCCC1 |
| InChI | InChI=1S/C32H46O3S2/c1-20(2)25-16-27(21(3)4)32(28(17-25)22(5)6)37(33,34)35-26-18-29(23-12-8-9-13-23)31(36-7)30(19-26)24-14-10-11-15-24/h16-24H,8-15H2,1-7H3 |
| InChIKey | XNYAPUBYZCVXQF-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|