C20H26N4O3S — CID 175964753
7H-purin-6-yl 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 175964753) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 7H-purin-6-yl 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | 7H-purin-6-yl 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 175964753 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 7H-purin-6-yl 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Oc2ncnc3nc[nH]c23)c(C(C)C)c1 |
| InChI | InChI=1S/C20H26N4O3S/c1-11(2)14-7-15(12(3)4)18(16(8-14)13(5)6)28(25,26)27-20-17-19(22-9-21-17)23-10-24-20/h7-13H,1-6H3,(H,21,22,23,24) |
| InChIKey | ZUMJIFRQTZIXNC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|