C18H17NO2S — CID 163444417
1-phenyl-2'-sulfinylspiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 163444417) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-phenyl-2'-sulfinylspiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1-phenyl-2'-sulfinylspiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 163444417 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-phenyl-2'-sulfinylspiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | O=S=C1CC2(CCN1)OC(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C18H17NO2S/c20-22-16-12-18(10-11-19-16)15-9-5-4-8-14(15)17(21-18)13-6-2-1-3-7-13/h1-9,17,19H,10-12H2 |
| InChIKey | BBHCEXIEDYZHBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|