C17H19BrN2O — CID 21428792
1-pyridin-3-ylspiro[1H-2-benzofuran-3,4'-piperidine];hydrobromide (PubChem CID 21428792) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is 1-pyridin-3-ylspiro[1H-2-benzofuran-3,4'-piperidine];hydrobromide.
| Compound Name | 1-pyridin-3-ylspiro[1H-2-benzofuran-3,4'-piperidine];hydrobromide |
|---|---|
| PubChem CID | 21428792 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-pyridin-3-ylspiro[1H-2-benzofuran-3,4'-piperidine];hydrobromide |
| SMILES | Br.c1cncc(C2OC3(CCNCC3)c3ccccc32)c1 |
| InChI | InChI=1S/C17H18N2O.BrH/c1-2-6-15-14(5-1)16(13-4-3-9-19-12-13)20-17(15)7-10-18-11-8-17;/h1-6,9,12,16,18H,7-8,10-11H2;1H |
| InChIKey | HSJLDHNMMHDPAK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |