C24H27N3O5S — CID 163450345
N-[(1S)-3-[[1-[(3R)-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]-5-methylthiophene-2-carboxamide (PubChem CID 163450345) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[(1S)-3-[[1-[(3R)-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1S)-3-[[1-[(3R)-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 163450345 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[(1S)-3-[[1-[(3R)-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](CC(=O)NC(C(=O)[C@H]2CC(=O)NC2=O)C(C)C)c2ccccc2)s1 |
| InChI | InChI=1S/C24H27N3O5S/c1-13(2)21(22(30)16-11-19(28)27-23(16)31)26-20(29)12-17(15-7-5-4-6-8-15)25-24(32)18-10-9-14(3)33-18/h4-10,13,16-17,21H,11-12H2,1-3H3,(H,25,32)(H,26,29)(H,27,28,31)/t16-,17+,21?/m1/s1 |
| InChIKey | BGBFWUPVOBPPHL-LXMSXWCSSA-N |
| XLogP | 2.29 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|