C16H23ClN4O2 — CID 163456228
tert-butyl N-[(1S)-1-[1-(4-chlorophenyl)-3-methyl-2H-triazol-4-yl]ethyl]carbamate (PubChem CID 163456228) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[1-(4-chlorophenyl)-3-methyl-2H-triazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[1-(4-chlorophenyl)-3-methyl-2H-triazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 163456228 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | tert-butyl N-[(1S)-1-[1-(4-chlorophenyl)-3-methyl-2H-triazol-4-yl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C1=CN(c2ccc(Cl)cc2)NN1C |
| InChI | InChI=1S/C16H23ClN4O2/c1-11(18-15(22)23-16(2,3)4)14-10-21(19-20(14)5)13-8-6-12(17)7-9-13/h6-11,19H,1-5H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | BKSRAZKPJAGDSK-NSHDSACASA-N |
| XLogP | 3.27 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |