C24H23NO5 — CID 163457078
5-(4-methoxynaphthalen-1-yl)iminospiro[1,3-dioxane-2,2'-adamantane]-4,6-dione (PubChem CID 163457078) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 5-(4-methoxynaphthalen-1-yl)iminospiro[1,3-dioxane-2,2'-adamantane]-4,6-dione.
| Compound Name | 5-(4-methoxynaphthalen-1-yl)iminospiro[1,3-dioxane-2,2'-adamantane]-4,6-dione |
|---|---|
| PubChem CID | 163457078 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-(4-methoxynaphthalen-1-yl)iminospiro[1,3-dioxane-2,2'-adamantane]-4,6-dione |
| SMILES | COc1ccc(N=C2C(=O)OC3(OC2=O)C2CC4CC(C2)CC3C4)c2ccccc12 |
| InChI | InChI=1S/C24H23NO5/c1-28-20-7-6-19(17-4-2-3-5-18(17)20)25-21-22(26)29-24(30-23(21)27)15-9-13-8-14(11-15)12-16(24)10-13/h2-7,13-16H,8-12H2,1H3/b25-21- |
| InChIKey | BLJIEADRJVCQDZ-DAFNUICNSA-N |
| XLogP | 4.17 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|