C16H23ClN2 — CID 163457536
2-chloro-4,6-di(cyclohex-2-en-1-yl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 163457536) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 2-chloro-4,6-di(cyclohex-2-en-1-yl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-chloro-4,6-di(cyclohex-2-en-1-yl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 163457536 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-chloro-4,6-di(cyclohex-2-en-1-yl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | ClC1=NC(C2C=CCCC2)CC(C2C=CCCC2)N1 |
| InChI | InChI=1S/C16H23ClN2/c17-16-18-14(12-7-3-1-4-8-12)11-15(19-16)13-9-5-2-6-10-13/h3,5,7,9,12-15H,1-2,4,6,8,10-11H2,(H,18,19) |
| InChIKey | BLTCBHXAUBRGIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|