C17H31N3 — CID 173268153
10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine (PubChem CID 173268153) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine.
| Compound Name | 10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine |
|---|---|
| PubChem CID | 173268153 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine |
| SMILES | C1=CC(C2CCNCCC/N=C\N2)CCCCCCC1 |
| InChI | InChI=1S/C17H31N3/c1-2-4-6-9-16(10-7-5-3-1)17-11-14-18-12-8-13-19-15-20-17/h6,9,15-18H,1-5,7-8,10-14H2,(H,19,20) |
| InChIKey | MBQAUCPWUWNSAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|