C17H21N3OS — CID 163460408
(2-amino-5-thiophen-2-ylanilino)-(7-azabicyclo[2.2.1]heptan-7-yl)methanol (PubChem CID 163460408) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is (2-amino-5-thiophen-2-ylanilino)-(7-azabicyclo[2.2.1]heptan-7-yl)methanol.
| Compound Name | (2-amino-5-thiophen-2-ylanilino)-(7-azabicyclo[2.2.1]heptan-7-yl)methanol |
|---|---|
| PubChem CID | 163460408 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2-amino-5-thiophen-2-ylanilino)-(7-azabicyclo[2.2.1]heptan-7-yl)methanol |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(O)N1C2CCC1CC2 |
| InChI | InChI=1S/C17H21N3OS/c18-14-8-3-11(16-2-1-9-22-16)10-15(14)19-17(21)20-12-4-5-13(20)7-6-12/h1-3,8-10,12-13,17,19,21H,4-7,18H2 |
| InChIKey | BOBSWHJZEVENOS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|