C9H19BO4 — CID 163463496
[(2R,3R,5S)-2,5-dimethyloxolan-3-yl]oxymethyl-dimethoxyborane (PubChem CID 163463496) has the molecular formula C9H19BO4 and a molecular weight of 202.06 g/mol. Its IUPAC name is [(2R,3R,5S)-2,5-dimethyloxolan-3-yl]oxymethyl-dimethoxyborane.
| Compound Name | [(2R,3R,5S)-2,5-dimethyloxolan-3-yl]oxymethyl-dimethoxyborane |
|---|---|
| PubChem CID | 163463496 |
| Molecular Formula | C9H19BO4 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [(2R,3R,5S)-2,5-dimethyloxolan-3-yl]oxymethyl-dimethoxyborane |
| SMILES | COB(CO[C@@H]1C[C@H](C)O[C@@H]1C)OC |
| InChI | InChI=1S/C9H19BO4/c1-7-5-9(8(2)14-7)13-6-10(11-3)12-4/h7-9H,5-6H2,1-4H3/t7-,8+,9+/m0/s1 |
| InChIKey | PPODNFDNFYWWDI-DJLDLDEBSA-N |
| XLogP | 0.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|