C19H34N2O8 — CID 59364473
[(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamate (PubChem CID 59364473) has the molecular formula C19H34N2O8 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamate.
| Compound Name | [(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 59364473 |
| Molecular Formula | C19H34N2O8 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6S)-4-methoxy-2,6-dimethyloxan-3-yl]carbamate |
| SMILES | CO[C@H]1C[C@H](C)O[C@@H](C)[C@H]1NC(=O)OCOC(=O)N[C@@H]1[C@H](C)O[C@@H](C)C[C@@H]1OC |
| InChI | InChI=1S/C19H34N2O8/c1-10-7-14(24-5)16(12(3)28-10)20-18(22)26-9-27-19(23)21-17-13(4)29-11(2)8-15(17)25-6/h10-17H,7-9H2,1-6H3,(H,20,22)(H,21,23)/t10-,11-,12-,13-,14-,15-,16+,17+/m0/s1 |
| InChIKey | LZJKUNWYEVXUHR-RPOKEFSISA-N |
| XLogP | 1.56 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|