C10H19NO5 — CID 13115571
ethyl N-[(2R,3S,4R)-2,4-dimethoxyoxan-3-yl]carbamate (PubChem CID 13115571) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is ethyl N-[(2R,3S,4R)-2,4-dimethoxyoxan-3-yl]carbamate.
| Compound Name | ethyl N-[(2R,3S,4R)-2,4-dimethoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 13115571 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | ethyl N-[(2R,3S,4R)-2,4-dimethoxyoxan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1[C@H](OC)OCC[C@H]1OC |
| InChI | InChI=1S/C10H19NO5/c1-4-15-10(12)11-8-7(13-2)5-6-16-9(8)14-3/h7-9H,4-6H2,1-3H3,(H,11,12)/t7-,8+,9-/m1/s1 |
| InChIKey | INHOGFJULBBPAM-HRDYMLBCSA-N |
| XLogP | 0.51 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |