C14H25NO7 — CID 89061570
4-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxy]butyl formate (PubChem CID 89061570) has the molecular formula C14H25NO7 and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxy]butyl formate.
| Compound Name | 4-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxy]butyl formate |
|---|---|
| PubChem CID | 89061570 |
| Molecular Formula | C14H25NO7 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxy]butyl formate |
| SMILES | CO[C@H]1C[C@H](OC)[C@H](NC(=O)OCCCCOC=O)[C@H](C)O1 |
| InChI | InChI=1S/C14H25NO7/c1-10-13(11(18-2)8-12(19-3)22-10)15-14(17)21-7-5-4-6-20-9-16/h9-13H,4-8H2,1-3H3,(H,15,17)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | AGOWRMQDHRBGBL-WUHRBBMRSA-N |
| XLogP | 0.83 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|