C48H92N8O20 — CID 158859159
1-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxy-3-[6-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxycarbamoylamino]hexyl]urea (PubChem CID 158859159) has the molecular formula C48H92N8O20 and a molecular weight of 1101.30 g/mol. Its IUPAC name is 1-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxy-3-[6-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxycarbamoylamino]hexyl]urea.
| Compound Name | 1-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxy-3-[6-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxycarbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 158859159 |
| Molecular Formula | C48H92N8O20 |
| Molecular Weight | 1101.30 g/mol |
| Exact Mass | 1100.64 |
| IUPAC Name | 1-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxy-3-[6-[[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]oxycarbamoylamino]hexyl]urea |
| SMILES | CO[C@H]1C[C@H](OC)[C@H](ONC(=O)NCCCCCCNC(=O)NO[C@@H]2[C@H](C)O[C@@H](OC)C[C@@H]2OC)[C@H](C)O1.CO[C@H]1C[C@H](OC)[C@H](ONC(=O)NCCCCCCNC(=O)NO[C@@H]2[C@H](C)O[C@@H](OC)C[C@@H]2OC)[C@H](C)O1 |
| InChI | InChI=1S/2C24H46N4O10/c2*1-15-21(17(31-3)13-19(33-5)35-15)37-27-23(29)25-11-9-7-8-10-12-26-24(30)28-38-22-16(2)36-20(34-6)14-18(22)32-4/h2*15-22H,7-14H2,1-6H3,(H2,25,27,29)(H2,26,28,30)/t2*15-,16-,17-,18-,19+,20+,21+,22+/m00/s1 |
| InChIKey | JALAUQKQLUBBJS-WCFQXGDNSA-N |
| XLogP | 2.68 |
| TPSA | 312.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|