C11H21NO4 — CID 162903050
N-(4,6-dimethoxy-2-methyloxan-3-yl)-N-methylacetamide (PubChem CID 162903050) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-(4,6-dimethoxy-2-methyloxan-3-yl)-N-methylacetamide.
| Compound Name | N-(4,6-dimethoxy-2-methyloxan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 162903050 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-(4,6-dimethoxy-2-methyloxan-3-yl)-N-methylacetamide |
| SMILES | COC1CC(OC)C(N(C)C(C)=O)C(C)O1 |
| InChI | InChI=1S/C11H21NO4/c1-7-11(12(3)8(2)13)9(14-4)6-10(15-5)16-7/h7,9-11H,6H2,1-5H3 |
| InChIKey | DEOXZKRLUAPGRF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |