C10H17ClO4 — CID 10561834
[(2S,3R,4S,6R)-4-chloro-6-methoxy-2-methyloxan-3-yl] propanoate (PubChem CID 10561834) has the molecular formula C10H17ClO4 and a molecular weight of 236.69 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-4-chloro-6-methoxy-2-methyloxan-3-yl] propanoate.
| Compound Name | [(2S,3R,4S,6R)-4-chloro-6-methoxy-2-methyloxan-3-yl] propanoate |
|---|---|
| PubChem CID | 10561834 |
| Molecular Formula | C10H17ClO4 |
| Molecular Weight | 236.69 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | [(2S,3R,4S,6R)-4-chloro-6-methoxy-2-methyloxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@H](C)O[C@@H](OC)C[C@@H]1Cl |
| InChI | InChI=1S/C10H17ClO4/c1-4-8(12)15-10-6(2)14-9(13-3)5-7(10)11/h6-7,9-10H,4-5H2,1-3H3/t6-,7-,9+,10+/m0/s1 |
| InChIKey | FMVVXIHVQMBQSW-AKEJEFCPSA-N |
| XLogP | 1.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.69 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|