C22H22F6N5O+ — CID 163466263
3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-4-ium-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole (PubChem CID 163466263) has the molecular formula C22H22F6N5O+ and a molecular weight of 486.44 g/mol. Its IUPAC name is 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-4-ium-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-4-ium-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 163466263 |
| Molecular Formula | C22H22F6N5O+ |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-4-ium-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole |
| SMILES | C[NH+]1C(c2ccccc2C(F)(F)F)=NN=C1C12CCC(c3noc(CC(F)(F)F)n3)(CC1)CC2 |
| InChI | InChI=1S/C22H21F6N5O/c1-33-16(13-4-2-3-5-14(13)22(26,27)28)30-31-18(33)20-9-6-19(7-10-20,8-11-20)17-29-15(34-32-17)12-21(23,24)25/h2-5H,6-12H2,1H3/p+1 |
| InChIKey | BSWKABWWQZGVJP-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |