C24H42N4O — CID 163466269
(2S,6R)-4-(4-tert-butyl-2-pyridinyl)-2,6-dimethyl-1-[2-(2-piperidin-1-ylethoxy)ethyl]piperazine (PubChem CID 163466269) has the molecular formula C24H42N4O and a molecular weight of 402.63 g/mol. Its IUPAC name is (2S,6R)-4-(4-tert-butyl-2-pyridinyl)-2,6-dimethyl-1-[2-(2-piperidin-1-ylethoxy)ethyl]piperazine.
| Compound Name | (2S,6R)-4-(4-tert-butyl-2-pyridinyl)-2,6-dimethyl-1-[2-(2-piperidin-1-ylethoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 163466269 |
| Molecular Formula | C24H42N4O |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.34 |
| IUPAC Name | (2S,6R)-4-(4-tert-butyl-2-pyridinyl)-2,6-dimethyl-1-[2-(2-piperidin-1-ylethoxy)ethyl]piperazine |
| SMILES | C[C@@H]1CN(c2cc(C(C)(C)C)ccn2)C[C@H](C)N1CCOCCN1CCCCC1 |
| InChI | InChI=1S/C24H42N4O/c1-20-18-27(23-17-22(9-10-25-23)24(3,4)5)19-21(2)28(20)14-16-29-15-13-26-11-7-6-8-12-26/h9-10,17,20-21H,6-8,11-16,18-19H2,1-5H3/t20-,21+ |
| InChIKey | KZOKQNOEMNOXMU-OYRHEFFESA-N |
| XLogP | 3.78 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|